C14H16N2OS2 — CID 142869078
(Z)-3-amino-4-phenyl-1-sulfanylidene-1-(1,3-thiazinan-3-yl)but-3-en-2-one (PubChem CID 142869078) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (Z)-3-amino-4-phenyl-1-sulfanylidene-1-(1,3-thiazinan-3-yl)but-3-en-2-one.
| Compound Name | (Z)-3-amino-4-phenyl-1-sulfanylidene-1-(1,3-thiazinan-3-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 142869078 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (Z)-3-amino-4-phenyl-1-sulfanylidene-1-(1,3-thiazinan-3-yl)but-3-en-2-one |
| SMILES | N/C(=C\c1ccccc1)C(=O)C(=S)N1CCCSC1 |
| InChI | InChI=1S/C14H16N2OS2/c15-12(9-11-5-2-1-3-6-11)13(17)14(18)16-7-4-8-19-10-16/h1-3,5-6,9H,4,7-8,10,15H2/b12-9- |
| InChIKey | DOGSVKFEUWJQDR-XFXZXTDPSA-N |
| XLogP | 2.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|