C18H21N — CID 11402493
(E)-2,3-diphenyl-N-propan-2-ylprop-2-en-1-amine (PubChem CID 11402493) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (E)-2,3-diphenyl-N-propan-2-ylprop-2-en-1-amine.
| Compound Name | (E)-2,3-diphenyl-N-propan-2-ylprop-2-en-1-amine |
|---|---|
| PubChem CID | 11402493 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (E)-2,3-diphenyl-N-propan-2-ylprop-2-en-1-amine |
| SMILES | CC(C)NC/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-15(2)19-14-18(17-11-7-4-8-12-17)13-16-9-5-3-6-10-16/h3-13,15,19H,14H2,1-2H3/b18-13- |
| InChIKey | AZXDJIHDOPWVNM-AQTBWJFISA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|