C17H17NO — CID 101473048
N-[(E)-2,3-diphenylprop-2-enyl]-N-methylformamide (PubChem CID 101473048) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(E)-2,3-diphenylprop-2-enyl]-N-methylformamide.
| Compound Name | N-[(E)-2,3-diphenylprop-2-enyl]-N-methylformamide |
|---|---|
| PubChem CID | 101473048 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[(E)-2,3-diphenylprop-2-enyl]-N-methylformamide |
| SMILES | CN(C=O)C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO/c1-18(14-19)13-17(16-10-6-3-7-11-16)12-15-8-4-2-5-9-15/h2-12,14H,13H2,1H3/b17-12- |
| InChIKey | YMAYBPUCWSRBFG-ATVHPVEESA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|