C24H24N2O2 — CID 177366331
4-[[(E)-2,3-diphenylprop-2-enyl]amino]-N-(2-hydroxyethyl)benzamide (PubChem CID 177366331) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[[(E)-2,3-diphenylprop-2-enyl]amino]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-[[(E)-2,3-diphenylprop-2-enyl]amino]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 177366331 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-[[(E)-2,3-diphenylprop-2-enyl]amino]-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1ccc(NC/C(=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c27-16-15-25-24(28)21-11-13-23(14-12-21)26-18-22(20-9-5-2-6-10-20)17-19-7-3-1-4-8-19/h1-14,17,26-27H,15-16,18H2,(H,25,28)/b22-17- |
| InChIKey | RURCXBXXOUAKLG-XLNRJJMWSA-N |
| XLogP | 4.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|