C26H22N2 — CID 101201444
2-[(E)-1,4,5-triphenylpent-4-enyl]propanedinitrile (PubChem CID 101201444) has the molecular formula C26H22N2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[(E)-1,4,5-triphenylpent-4-enyl]propanedinitrile.
| Compound Name | 2-[(E)-1,4,5-triphenylpent-4-enyl]propanedinitrile |
|---|---|
| PubChem CID | 101201444 |
| Molecular Formula | C26H22N2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[(E)-1,4,5-triphenylpent-4-enyl]propanedinitrile |
| SMILES | N#CC(C#N)C(CC/C(=C\c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22N2/c27-19-25(20-28)26(23-14-8-3-9-15-23)17-16-24(22-12-6-2-7-13-22)18-21-10-4-1-5-11-21/h1-15,18,25-26H,16-17H2/b24-18+ |
| InChIKey | ZSTPKYNJZULYTA-HKOYGPOVSA-N |
| XLogP | 6.45 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|