C20H22O3 — CID 23974829
(2Z,4R,7Z)-8-(4-hydroxyphenyl)-7-phenylocta-2,7-diene-1,4-diol (PubChem CID 23974829) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2Z,4R,7Z)-8-(4-hydroxyphenyl)-7-phenylocta-2,7-diene-1,4-diol.
| Compound Name | (2Z,4R,7Z)-8-(4-hydroxyphenyl)-7-phenylocta-2,7-diene-1,4-diol |
|---|---|
| PubChem CID | 23974829 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (2Z,4R,7Z)-8-(4-hydroxyphenyl)-7-phenylocta-2,7-diene-1,4-diol |
| SMILES | OC/C=C\[C@H](O)CC/C(=C/c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O3/c21-14-4-7-19(22)13-10-18(17-5-2-1-3-6-17)15-16-8-11-20(23)12-9-16/h1-9,11-12,15,19,21-23H,10,13-14H2/b7-4-,18-15-/t19-/m0/s1 |
| InChIKey | XZSVZHRWFVFABQ-FEQXXZDUSA-N |
| XLogP | 3.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|