C19H20BrNO3 — CID 135754904
(2Z,4R,7Z)-8-(5-bromo-2-hydroxyphenyl)-7-pyridin-2-ylocta-2,7-diene-1,4-diol (PubChem CID 135754904) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is (2Z,4R,7Z)-8-(5-bromo-2-hydroxyphenyl)-7-pyridin-2-ylocta-2,7-diene-1,4-diol.
| Compound Name | (2Z,4R,7Z)-8-(5-bromo-2-hydroxyphenyl)-7-pyridin-2-ylocta-2,7-diene-1,4-diol |
|---|---|
| PubChem CID | 135754904 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (2Z,4R,7Z)-8-(5-bromo-2-hydroxyphenyl)-7-pyridin-2-ylocta-2,7-diene-1,4-diol |
| SMILES | OC/C=C\[C@H](O)CC/C(=C/c1cc(Br)ccc1O)c1ccccn1 |
| InChI | InChI=1S/C19H20BrNO3/c20-16-7-9-19(24)15(13-16)12-14(18-5-1-2-10-21-18)6-8-17(23)4-3-11-22/h1-5,7,9-10,12-13,17,22-24H,6,8,11H2/b4-3-,14-12-/t17-/m0/s1 |
| InChIKey | NQGATXAXWGDLJD-LXAYABTISA-N |
| XLogP | 3.78 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|