C13H11BrN4O — CID 4685121
N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]pyridine-2-carboximidamide (PubChem CID 4685121) has the molecular formula C13H11BrN4O and a molecular weight of 319.16 g/mol. Its IUPAC name is N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]pyridine-2-carboximidamide.
| Compound Name | N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 4685121 |
| Molecular Formula | C13H11BrN4O |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]pyridine-2-carboximidamide |
| SMILES | NC(=NN=Cc1cc(Br)ccc1O)c1ccccn1 |
| InChI | InChI=1S/C13H11BrN4O/c14-10-4-5-12(19)9(7-10)8-17-18-13(15)11-3-1-2-6-16-11/h1-8,19H,(H2,15,18) |
| InChIKey | CCFPAMLOTMQGGA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|