C33H39BrN2O5 — CID 135799124
(3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-2-cyclohexyl-6-ethyl-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135799124) has the molecular formula C33H39BrN2O5 and a molecular weight of 623.59 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-2-cyclohexyl-6-ethyl-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-2-cyclohexyl-6-ethyl-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135799124 |
| Molecular Formula | C33H39BrN2O5 |
| Molecular Weight | 623.59 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | (3aS,4R,7aR)-5-[(Z,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-2-cyclohexyl-6-ethyl-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2cc(Br)ccc2O)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H39BrN2O5/c1-2-20-18-25-31(33(41)36(32(25)40)24-8-4-3-5-9-24)26(19-37)30(20)29(39)13-11-21(27-10-6-7-15-35-27)16-22-17-23(34)12-14-28(22)38/h6-7,10,12,14-17,24-26,29,31,37-39H,2-5,8-9,11,13,18-19H2,1H3/b21-16-/t25-,26+,29-,31-/m1/s1 |
| InChIKey | KKBHGNVWHCRJQP-AIHXPUMQSA-N |
| XLogP | 5.88 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|