C33H35BN2O7 — CID 135707570
[3-[(3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid (PubChem CID 135707570) has the molecular formula C33H35BN2O7 and a molecular weight of 582.46 g/mol. Its IUPAC name is [3-[(3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 135707570 |
| Molecular Formula | C33H35BN2O7 |
| Molecular Weight | 582.46 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | [3-[(3aS,4R,7aR)-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2ccccc2O)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H35BN2O7/c1-2-20-17-25-31(33(41)36(32(25)40)24-10-7-9-23(18-24)34(42)43)26(19-37)30(20)29(39)14-13-21(27-11-5-6-15-35-27)16-22-8-3-4-12-28(22)38/h3-12,15-16,18,25-26,29,31,37-39,42-43H,2,13-14,17,19H2,1H3/b21-16-/t25-,26+,29-,31-/m1/s1 |
| InChIKey | RKIHLBASKCWWLO-AIHXPUMQSA-N |
| XLogP | 2.67 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|