C33H33BFNO8 — CID 23834261
[3-[(3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid (PubChem CID 23834261) has the molecular formula C33H33BFNO8 and a molecular weight of 601.44 g/mol. Its IUPAC name is [3-[(3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23834261 |
| Molecular Formula | C33H33BFNO8 |
| Molecular Weight | 601.44 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | [3-[(3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1[C@@H]2[C@@H](CC(CO)=C([C@H](O)CC/C(=C/c3ccc(O)c(F)c3)c3ccccc3)[C@@H]2CO)C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C33H33BFNO8/c35-27-14-19(9-11-28(27)39)13-21(20-5-2-1-3-6-20)10-12-29(40)30-22(17-37)15-25-31(26(30)18-38)33(42)36(32(25)41)24-8-4-7-23(16-24)34(43)44/h1-9,11,13-14,16,25-26,29,31,37-40,43-44H,10,12,15,17-18H2/b21-13-/t25-,26+,29-,31-/m1/s1 |
| InChIKey | YIBBYOKYNVEENR-UGRKKQMZSA-N |
| XLogP | 2.00 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|