C33H36BNO7 — CID 23890487
[3-[(3aS,4R,7aR)-6-ethyl-5-[(E,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid (PubChem CID 23890487) has the molecular formula C33H36BNO7 and a molecular weight of 569.46 g/mol. Its IUPAC name is [3-[(3aS,4R,7aR)-6-ethyl-5-[(E,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,4R,7aR)-6-ethyl-5-[(E,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23890487 |
| Molecular Formula | C33H36BNO7 |
| Molecular Weight | 569.46 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | [3-[(3aS,4R,7aR)-6-ethyl-5-[(E,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
| SMILES | CCC1=C([C@H](O)CC/C(C)=C/c2ccc(O)c3ccccc23)[C@H](CO)[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H36BNO7/c1-3-20-16-26-31(33(40)35(32(26)39)23-8-6-7-22(17-23)34(41)42)27(18-36)30(20)29(38)13-11-19(2)15-21-12-14-28(37)25-10-5-4-9-24(21)25/h4-10,12,14-15,17,26-27,29,31,36-38,41-42H,3,11,13,16,18H2,1-2H3/b19-15+/t26-,27+,29-,31-/m1/s1 |
| InChIKey | OUHYRHDGPQHDAM-KYODADNHSA-N |
| XLogP | 3.29 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|