C32H40BNO7 — CID 23918366
[3-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid (PubChem CID 23918366) has the molecular formula C32H40BNO7 and a molecular weight of 561.48 g/mol. Its IUPAC name is [3-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23918366 |
| Molecular Formula | C32H40BNO7 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | [3-[(3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxy-3,5-dimethylphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2cc(C)c(O)c(C)c2)CC)[C@H](CO)[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C32H40BNO7/c1-5-20(14-21-12-18(3)30(37)19(4)13-21)10-11-27(36)28-22(6-2)15-25-29(26(28)17-35)32(39)34(31(25)38)24-9-7-8-23(16-24)33(40)41/h7-9,12-14,16,25-27,29,35-37,40-41H,5-6,10-11,15,17H2,1-4H3/b20-14+/t25-,26+,27-,29-/m1/s1 |
| InChIKey | RDOSQXHZYKJHCJ-WOBKOYESSA-N |
| XLogP | 3.15 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|