C31H37BBrNO7 — CID 23747218
[3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid (PubChem CID 23747218) has the molecular formula C31H37BBrNO7 and a molecular weight of 626.35 g/mol. Its IUPAC name is [3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23747218 |
| Molecular Formula | C31H37BBrNO7 |
| Molecular Weight | 626.35 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | [3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
| SMILES | CC/C(=C\c1cc(Br)ccc1O)CC[C@@H](O)C1=C(C(C)C)C[C@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C31H37BBrNO7/c1-4-18(12-19-13-21(33)9-11-26(19)36)8-10-27(37)28-23(17(2)3)15-24-29(25(28)16-35)31(39)34(30(24)38)22-7-5-6-20(14-22)32(40)41/h5-7,9,11-14,17,24-25,27,29,35-37,40-41H,4,8,10,15-16H2,1-3H3/b18-12+/t24-,25+,27-,29-/m1/s1 |
| InChIKey | MQPHGYRKXVXBPV-DBZOMRIDSA-N |
| XLogP | 3.54 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|