C30H40BrNO7 — CID 23747208
6-[(3aS,4R,7aR)-5-[(E,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid (PubChem CID 23747208) has the molecular formula C30H40BrNO7 and a molecular weight of 606.55 g/mol. Its IUPAC name is 6-[(3aS,4R,7aR)-5-[(E,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,4R,7aR)-5-[(E,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23747208 |
| Molecular Formula | C30H40BrNO7 |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 6-[(3aS,4R,7aR)-5-[(E,1R)-5-(5-bromo-2-hydroxyphenyl)-1-hydroxy-4-methylpent-4-enyl]-4-(hydroxymethyl)-1,3-dioxo-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
| SMILES | C/C(=C\c1cc(Br)ccc1O)CC[C@@H](O)C1=C(C(C)C)C[C@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C30H40BrNO7/c1-17(2)21-15-22-28(30(39)32(29(22)38)12-6-4-5-7-26(36)37)23(16-33)27(21)25(35)10-8-18(3)13-19-14-20(31)9-11-24(19)34/h9,11,13-14,17,22-23,25,28,33-35H,4-8,10,12,15-16H2,1-3H3,(H,36,37)/b18-13+/t22-,23+,25-,28-/m1/s1 |
| InChIKey | RATGZELHVOWSMN-GALBQGEDSA-N |
| XLogP | 4.91 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|