C29H40BrNO5 — CID 23974452
(3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23974452) has the molecular formula C29H40BrNO5 and a molecular weight of 562.55 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23974452 |
| Molecular Formula | C29H40BrNO5 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyheptyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC1=C([C@H](O)CC/C(=C/c2cc(Br)ccc2O)CCC)[C@H](CO)[C@@H]2C(=O)N(CCC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H40BrNO5/c1-4-7-18(14-20-15-21(30)10-12-24(20)33)9-11-25(34)26-19(8-5-2)16-22-27(23(26)17-32)29(36)31(13-6-3)28(22)35/h10,12,14-15,22-23,25,27,32-34H,4-9,11,13,16-17H2,1-3H3/b18-14+/t22-,23+,25-,27-/m1/s1 |
| InChIKey | LOBDVFYYLSPKRF-KKXRBHQQSA-N |
| XLogP | 5.60 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|