C32H41NO6 — CID 23834329
(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23834329) has the molecular formula C32H41NO6 and a molecular weight of 535.68 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23834329 |
| Molecular Formula | C32H41NO6 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-propyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC/C(=C\c1ccc(O)c2ccccc12)CC[C@@H](O)C1=C(COC)C[C@H]2C(=O)N(CCC)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C32H41NO6/c1-4-8-20(16-21-12-14-27(35)24-10-7-6-9-23(21)24)11-13-28(36)29-22(19-39-3)17-25-30(26(29)18-34)32(38)33(15-5-2)31(25)37/h6-7,9-10,12,14,16,25-26,28,30,34-36H,4-5,8,11,13,15,17-19H2,1-3H3/b20-16+/t25-,26+,28-,30-/m1/s1 |
| InChIKey | VMWJFMMZPVCAQH-GDPKMGMGSA-N |
| XLogP | 4.84 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|