C33H41NO8 — CID 23834320
6-[(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid (PubChem CID 23834320) has the molecular formula C33H41NO8 and a molecular weight of 579.69 g/mol. Its IUPAC name is 6-[(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 23834320 |
| Molecular Formula | C33H41NO8 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 6-[(3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]hexanoic acid |
| SMILES | CC/C(=C\c1ccc(O)c2ccccc12)CC[C@@H](O)C1=C(CO)C[C@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C33H41NO8/c1-2-20(16-21-12-14-27(37)24-9-6-5-8-23(21)24)11-13-28(38)30-22(18-35)17-25-31(26(30)19-36)33(42)34(32(25)41)15-7-3-4-10-29(39)40/h5-6,8-9,12,14,16,25-26,28,31,35-38H,2-4,7,10-11,13,15,17-19H2,1H3,(H,39,40)/b20-16+/t25-,26+,28-,31-/m1/s1 |
| InChIKey | DLJZFWPVLXMUHM-FDEVEKQUSA-N |
| XLogP | 4.03 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|