C34H43NO6 — CID 23747277
(3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23747277) has the molecular formula C34H43NO6 and a molecular weight of 561.72 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23747277 |
| Molecular Formula | C34H43NO6 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1ccc(O)c2ccccc12)CC[C@@H](O)C1=C(COC)C[C@H]2C(=O)N(C3CCCCC3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C34H43NO6/c1-3-21(17-22-14-16-29(37)26-12-8-7-11-25(22)26)13-15-30(38)31-23(20-41-2)18-27-32(28(31)19-36)34(40)35(33(27)39)24-9-5-4-6-10-24/h7-8,11-12,14,16-17,24,27-28,30,32,36-38H,3-6,9-10,13,15,18-20H2,1-2H3/b21-17+/t27-,28+,30-,32-/m1/s1 |
| InChIKey | MRPNVEAQSLATFH-BEFOEPMTSA-N |
| XLogP | 5.37 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|