C31H43NO5 — CID 23974250
(3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23974250) has the molecular formula C31H43NO5 and a molecular weight of 509.69 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23974250 |
| Molecular Formula | C31H43NO5 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1cccc(O)c1)CC[C@@H](O)C1=C(C(C)C)C[C@H]2C(=O)N(C3CCCCC3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C31H43NO5/c1-4-20(15-21-9-8-12-23(34)16-21)13-14-27(35)28-24(19(2)3)17-25-29(26(28)18-33)31(37)32(30(25)36)22-10-6-5-7-11-22/h8-9,12,15-16,19,22,25-27,29,33-35H,4-7,10-11,13-14,17-18H2,1-3H3/b20-15+/t25-,26+,27-,29-/m1/s1 |
| InChIKey | VUHWKCSSQCSAEU-MESIWSNPSA-N |
| XLogP | 5.23 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|