C26H33NO7 — CID 23747040
methyl (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 23747040) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 23747040 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | methyl (3aS,4R,7aR)-6-ethyl-5-[(1R,4E)-1-hydroxy-4-[(3-hydroxyphenyl)methylidene]hexyl]-4-(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2cccc(O)c2)CC)[C@H](CO)[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C26H33NO7/c1-4-15(11-16-7-6-8-18(29)12-16)9-10-21(30)22-17(5-2)13-19-23(20(22)14-28)25(32)27(24(19)31)26(33)34-3/h6-8,11-12,19-21,23,28-30H,4-5,9-10,13-14H2,1-3H3/b15-11+/t19-,20+,21-,23-/m1/s1 |
| InChIKey | VVOSKYKATHHPHK-UJEKYGOUSA-N |
| XLogP | 3.41 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|