C30H35NO8 — CID 23918510
methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 23918510) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 23918510 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CCC/C(=C\c1ccc(O)c2ccccc12)CC[C@@H](O)C1=C(CO)C[C@H]2C(=O)N(C(=O)OC)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C30H35NO8/c1-3-6-17(13-18-10-12-24(34)21-8-5-4-7-20(18)21)9-11-25(35)26-19(15-32)14-22-27(23(26)16-33)29(37)31(28(22)36)30(38)39-2/h4-5,7-8,10,12-13,22-23,25,27,32-35H,3,6,9,11,14-16H2,1-2H3/b17-13+/t22-,23+,25-,27-/m1/s1 |
| InChIKey | GIGKBUOVPFKXNI-HAIBSNLUSA-N |
| XLogP | 3.54 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|