C31H36BNO7 — CID 23862410
methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate (PubChem CID 23862410) has the molecular formula C31H36BNO7 and a molecular weight of 545.44 g/mol. Its IUPAC name is methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate.
| Compound Name | methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
|---|---|
| PubChem CID | 23862410 |
| Molecular Formula | C31H36BNO7 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | methyl (4R,6aR,9aS,9bR)-5-ethyl-2-hydroxy-4-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
| SMILES | CCC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OB(O)C[C@H]2C1=C(CC)C[C@H]1C(=O)N(C(=O)OC)C(=O)[C@H]12 |
| InChI | InChI=1S/C31H36BNO7/c1-4-8-18(15-20-12-13-25(34)22-10-7-6-9-21(20)22)11-14-26-27-19(5-2)16-23-28(24(27)17-32(38)40-26)30(36)33(29(23)35)31(37)39-3/h6-7,9-10,12-13,15,23-24,26,28,34,38H,4-5,8,11,14,16-17H2,1-3H3/b18-15+/t23-,24+,26-,28-/m1/s1 |
| InChIKey | WAMODVXMMZRUSZ-YQBJHHCISA-N |
| XLogP | 5.48 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|