C27H34BNO8 — CID 23945876
methyl (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-(methoxymethyl)-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate (PubChem CID 23945876) has the molecular formula C27H34BNO8 and a molecular weight of 511.38 g/mol. Its IUPAC name is methyl (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-(methoxymethyl)-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate.
| Compound Name | methyl (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-(methoxymethyl)-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
|---|---|
| PubChem CID | 23945876 |
| Molecular Formula | C27H34BNO8 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | methyl (4R,6aR,9aS,9bR)-2-hydroxy-4-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-5-(methoxymethyl)-7,9-dioxo-1,4,6,6a,9a,9b-hexahydrooxaborinino[4,5-e]isoindole-8-carboxylate |
| SMILES | CCC/C(=C\c1ccc(O)cc1)CC[C@H]1OB(O)C[C@H]2C1=C(COC)C[C@H]1C(=O)N(C(=O)OC)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H34BNO8/c1-4-5-16(12-17-6-9-19(30)10-7-17)8-11-22-23-18(15-35-2)13-20-24(21(23)14-28(34)37-22)26(32)29(25(20)31)27(33)36-3/h6-7,9-10,12,20-22,24,30,34H,4-5,8,11,13-15H2,1-3H3/b16-12+/t20-,21+,22-,24-/m1/s1 |
| InChIKey | OSDBBODPWYSTBA-ZPLGEEBSSA-N |
| XLogP | 3.57 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|