C26H31NO7 — CID 23747316
methyl (3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate (PubChem CID 23747316) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is methyl (3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate.
| Compound Name | methyl (3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
|---|---|
| PubChem CID | 23747316 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | methyl (3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
| SMILES | CCC/C(=C\c1ccc(O)cc1)CC[C@H]1OC[C@H]2C1=C(CO)C[C@H]1C(=O)N(C(=O)OC)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H31NO7/c1-3-4-15(11-16-5-8-18(29)9-6-16)7-10-21-22-17(13-28)12-19-23(20(22)14-34-21)25(31)27(24(19)30)26(32)33-2/h5-6,8-9,11,19-21,23,28-29H,3-4,7,10,12-14H2,1-2H3/b15-11+/t19-,20+,21-,23-/m1/s1 |
| InChIKey | QTBUUAXKWRUVKB-UJEKYGOUSA-N |
| XLogP | 3.43 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|