C36H44N2O5 — CID 23862720
(3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23862720) has the molecular formula C36H44N2O5 and a molecular weight of 584.76 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23862720 |
| Molecular Formula | C36H44N2O5 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(3E)-3-[(4-hydroxyphenyl)methylidene]hexyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC/C(=C\c1ccc(O)cc1)CC[C@H]1OC[C@H]2C1=C(CO)C[C@H]1C(=O)N(C3CCN(Cc4ccccc4)CC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C36H44N2O5/c1-2-6-24(19-25-9-12-29(40)13-10-25)11-14-32-33-27(22-39)20-30-34(31(33)23-43-32)36(42)38(35(30)41)28-15-17-37(18-16-28)21-26-7-4-3-5-8-26/h3-5,7-10,12-13,19,28,30-32,34,39-40H,2,6,11,14-18,20-23H2,1H3/b24-19+/t30-,31+,32-,34-/m1/s1 |
| InChIKey | GMMSHZGNYRYWCJ-RNVBSTPISA-N |
| XLogP | 5.33 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|