C38H41N3O5 — CID 23834374
(3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23834374) has the molecular formula C38H41N3O5 and a molecular weight of 619.76 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23834374 |
| Molecular Formula | C38H41N3O5 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-(hydroxymethyl)-3-[(Z)-4-(3-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | O=C1[C@@H]2[C@@H](CC(CO)=C3[C@@H](CC/C(=C/c4cccc(O)c4)c4ccccn4)OC[C@@H]32)C(=O)N1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C38H41N3O5/c42-23-28-21-31-36(38(45)41(37(31)44)29-14-17-40(18-15-29)22-25-7-2-1-3-8-25)32-24-46-34(35(28)32)13-12-27(33-11-4-5-16-39-33)19-26-9-6-10-30(43)20-26/h1-11,16,19-20,29,31-32,34,36,42-43H,12-15,17-18,21-24H2/b27-19-/t31-,32+,34-,36-/m1/s1 |
| InChIKey | PPNLTGLITDNILK-PNZSCSDMSA-N |
| XLogP | 5.08 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|