C39H43N3O4 — CID 135671064
(3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-ethyl-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135671064) has the molecular formula C39H43N3O4 and a molecular weight of 617.79 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-ethyl-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-ethyl-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135671064 |
| Molecular Formula | C39H43N3O4 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(1-benzylpiperidin-4-yl)-4-ethyl-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccc(O)cc3)c3ccccn3)OC[C@@H]2[C@@H]2C(=O)N(C3CCN(Cc4ccccc4)CC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C39H43N3O4/c1-2-28-23-32-37(39(45)42(38(32)44)30-17-20-41(21-18-30)24-27-8-4-3-5-9-27)33-25-46-35(36(28)33)16-13-29(34-10-6-7-19-40-34)22-26-11-14-31(43)15-12-26/h3-12,14-15,19,22,30,32-33,35,37,43H,2,13,16-18,20-21,23-25H2,1H3/b29-22-/t32-,33+,35-,37-/m1/s1 |
| InChIKey | LFLACGWHTMIMTB-PXZDMPCSSA-N |
| XLogP | 6.50 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|