C38H34N2O5 — CID 135707611
(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(phenoxymethyl)-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135707611) has the molecular formula C38H34N2O5 and a molecular weight of 598.70 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(phenoxymethyl)-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(phenoxymethyl)-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135707611 |
| Molecular Formula | C38H34N2O5 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(phenoxymethyl)-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | O=C1[C@@H]2[C@@H](CC(COc3ccccc3)=C3[C@@H](CC/C(=C/c4ccc(O)cc4)c4ccccn4)OC[C@@H]32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C38H34N2O5/c41-29-17-14-25(15-18-29)21-26(33-13-7-8-20-39-33)16-19-34-35-27(23-44-30-11-5-2-6-12-30)22-31-36(32(35)24-45-34)38(43)40(37(31)42)28-9-3-1-4-10-28/h1-15,17-18,20-21,31-32,34,36,41H,16,19,22-24H2/b26-21-/t31-,32+,34-,36-/m1/s1 |
| InChIKey | XEVNNECVOVAJPH-SAEHYDFYSA-N |
| XLogP | 6.71 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|