C35H36N2O5 — CID 135775618
(3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-methyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135775618) has the molecular formula C35H36N2O5 and a molecular weight of 564.68 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-methyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-methyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135775618 |
| Molecular Formula | C35H36N2O5 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-7-methyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | Cc1cc(/C=C(/CC[C@H]2OC[C@H]3C2=C(COc2ccccc2)C[C@H]2C(=O)N(C)C(=O)[C@H]23)c2ccccn2)cc(C)c1O |
| InChI | InChI=1S/C35H36N2O5/c1-21-15-23(16-22(2)33(21)38)17-24(29-11-7-8-14-36-29)12-13-30-31-25(19-41-26-9-5-4-6-10-26)18-27-32(28(31)20-42-30)35(40)37(3)34(27)39/h4-11,14-17,27-28,30,32,38H,12-13,18-20H2,1-3H3/b24-17-/t27-,28+,30-,32-/m1/s1 |
| InChIKey | DQMRNWVVJPADNN-FEWLFLJLSA-N |
| XLogP | 5.75 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|