C35H42N2O4 — CID 135569367
(3R,5aR,8aS,8bR)-7-cyclohexyl-4-ethyl-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135569367) has the molecular formula C35H42N2O4 and a molecular weight of 554.73 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-4-ethyl-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-4-ethyl-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135569367 |
| Molecular Formula | C35H42N2O4 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-4-ethyl-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3cc(C)c(O)c(C)c3)c3ccccn3)OC[C@@H]2[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H42N2O4/c1-4-24-19-27-32(35(40)37(34(27)39)26-10-6-5-7-11-26)28-20-41-30(31(24)28)14-13-25(29-12-8-9-15-36-29)18-23-16-21(2)33(38)22(3)17-23/h8-9,12,15-18,26-28,30,32,38H,4-7,10-11,13-14,19-20H2,1-3H3/b25-18-/t27-,28+,30-,32-/m1/s1 |
| InChIKey | KTLWRZLGDKDJKJ-IKJGKDQWSA-N |
| XLogP | 6.78 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|