C30H32N2O6 — CID 135779624
methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate (PubChem CID 135779624) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate.
| Compound Name | methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
|---|---|
| PubChem CID | 135779624 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(4-hydroxy-3,5-dimethylphenyl)-3-pyridin-2-ylbut-3-enyl]-4-methyl-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@@H]2[C@@H](CC(C)=C3[C@@H](CC/C(=C/c4cc(C)c(O)c(C)c4)c4ccccn4)OC[C@@H]32)C1=O |
| InChI | InChI=1S/C30H32N2O6/c1-16-13-21-26(29(35)32(28(21)34)30(36)37-4)22-15-38-24(25(16)22)9-8-20(23-7-5-6-10-31-23)14-19-11-17(2)27(33)18(3)12-19/h5-7,10-12,14,21-22,24,26,33H,8-9,13,15H2,1-4H3/b20-14-/t21-,22+,24-,26-/m1/s1 |
| InChIKey | FMHLBPJNCDKDOG-DHBAYJFJSA-N |
| XLogP | 4.83 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|