C29H29BrN2O7 — CID 135811161
methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate (PubChem CID 135811161) has the molecular formula C29H29BrN2O7 and a molecular weight of 597.46 g/mol. Its IUPAC name is methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate.
| Compound Name | methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
|---|---|
| PubChem CID | 135811161 |
| Molecular Formula | C29H29BrN2O7 |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | methyl (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-7-carboxylate |
| SMILES | COCC1=C2[C@@H](CC/C(=C/c3cc(Br)ccc3O)c3ccccn3)OC[C@@H]2[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H29BrN2O7/c1-37-14-18-13-20-26(28(35)32(27(20)34)29(36)38-2)21-15-39-24(25(18)21)9-6-16(22-5-3-4-10-31-22)11-17-12-19(30)7-8-23(17)33/h3-5,7-8,10-12,20-21,24,26,33H,6,9,13-15H2,1-2H3/b16-11-/t20-,21+,24-,26-/m1/s1 |
| InChIKey | GLGRXIGQJAILJS-WARBFWMPSA-N |
| XLogP | 4.60 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|