C40H38BrN3O4 — CID 135775634
(3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 135775634) has the molecular formula C40H38BrN3O4 and a molecular weight of 704.67 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 135775634 |
| Molecular Formula | C40H38BrN3O4 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 703.20 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-4-propyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3cc(Br)ccc3O)c3ccccn3)OC[C@@H]2[C@@H]2C(=O)N(c3ccc(Nc4ccccc4)cc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C40H38BrN3O4/c1-2-8-26-23-32-38(40(47)44(39(32)46)31-16-14-30(15-17-31)43-29-9-4-3-5-10-29)33-24-48-36(37(26)33)19-12-25(34-11-6-7-20-42-34)21-27-22-28(41)13-18-35(27)45/h3-7,9-11,13-18,20-22,32-33,36,38,43,45H,2,8,12,19,23-24H2,1H3/b25-21-/t32-,33+,36-,38-/m1/s1 |
| InChIKey | SOVXGMYGHBVCCB-NEYMZYHNSA-N |
| XLogP | 8.94 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|