C34H32BrNO4 — CID 23834591
(3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-phenylbut-3-enyl]-4-ethyl-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23834591) has the molecular formula C34H32BrNO4 and a molecular weight of 598.54 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-phenylbut-3-enyl]-4-ethyl-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-phenylbut-3-enyl]-4-ethyl-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23834591 |
| Molecular Formula | C34H32BrNO4 |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(5-bromo-2-hydroxyphenyl)-3-phenylbut-3-enyl]-4-ethyl-7-phenyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3cc(Br)ccc3O)c3ccccc3)OC[C@@H]2[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H32BrNO4/c1-2-21-19-27-32(34(39)36(33(27)38)26-11-7-4-8-12-26)28-20-40-30(31(21)28)16-13-23(22-9-5-3-6-10-22)17-24-18-25(35)14-15-29(24)37/h3-12,14-15,17-18,27-28,30,32,37H,2,13,16,19-20H2,1H3/b23-17-/t27-,28+,30-,32-/m1/s1 |
| InChIKey | CYONDBDFIJEWGV-OXGIOVTCSA-N |
| XLogP | 7.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|