C34H34BNO6 — CID 23918582
[3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 23918582) has the molecular formula C34H34BNO6 and a molecular weight of 563.46 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23918582 |
| Molecular Formula | C34H34BNO6 |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-4-ethyl-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3cccc(O)c3)c3ccccc3)OC[C@@H]2[C@@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H34BNO6/c1-2-22-18-28-32(34(39)36(33(28)38)26-12-7-11-25(19-26)35(40)41)29-20-42-30(31(22)29)15-14-24(23-9-4-3-5-10-23)16-21-8-6-13-27(37)17-21/h3-13,16-17,19,28-30,32,37,40-41H,2,14-15,18,20H2,1H3/b24-16-/t28-,29+,30-,32-/m1/s1 |
| InChIKey | BIXFIUBNMMTRCH-QMURIAHHSA-N |
| XLogP | 4.32 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|