C28H30BNO7 — CID 23974598
[3-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 23974598) has the molecular formula C28H30BNO7 and a molecular weight of 503.36 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23974598 |
| Molecular Formula | C28H30BNO7 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-4-(hydroxymethyl)-3-[(E)-4-(2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | C/C(=C\c1ccccc1O)CC[C@H]1OC[C@H]2C1=C(CO)C[C@H]1C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C28H30BNO7/c1-16(11-17-5-2-3-8-23(17)32)9-10-24-25-18(14-31)12-21-26(22(25)15-37-24)28(34)30(27(21)33)20-7-4-6-19(13-20)29(35)36/h2-8,11,13,21-22,24,26,31-32,35-36H,9-10,12,14-15H2,1H3/b16-11+/t21-,22+,24-,26-/m1/s1 |
| InChIKey | KQVICCMTVPTMDN-FXDCVTGTSA-N |
| XLogP | 1.77 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|