C35H38BNO7 — CID 23974818
[3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 23974818) has the molecular formula C35H38BNO7 and a molecular weight of 595.50 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23974818 |
| Molecular Formula | C35H38BNO7 |
| Molecular Weight | 595.50 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(methoxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | CCC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OC[C@H]2C1=C(COC)C[C@H]1C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C35H38BNO7/c1-3-7-21(16-22-13-14-30(38)27-11-5-4-10-26(22)27)12-15-31-32-23(19-43-2)17-28-33(29(32)20-44-31)35(40)37(34(28)39)25-9-6-8-24(18-25)36(41)42/h4-6,8-11,13-14,16,18,28-29,31,33,38,41-42H,3,7,12,15,17,19-20H2,1-2H3/b21-16+/t28-,29+,31-,33-/m1/s1 |
| InChIKey | XFJLTKHZRLHUFB-FVHJGARSSA-N |
| XLogP | 4.36 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|