C39H36BNO7 — CID 23834411
[3-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 23834411) has the molecular formula C39H36BNO7 and a molecular weight of 641.53 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23834411 |
| Molecular Formula | C39H36BNO7 |
| Molecular Weight | 641.53 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-3-[(Z)-4-(3-hydroxyphenyl)-3-phenylbut-3-enyl]-6,8-dioxo-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | O=C1[C@@H]2[C@@H](CC(COc3ccccc3)=C3[C@@H](CC/C(=C/c4cccc(O)c4)c4ccccc4)OC[C@@H]32)C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C39H36BNO7/c42-31-14-7-9-25(20-31)19-27(26-10-3-1-4-11-26)17-18-35-36-28(23-47-32-15-5-2-6-16-32)21-33-37(34(36)24-48-35)39(44)41(38(33)43)30-13-8-12-29(22-30)40(45)46/h1-16,19-20,22,33-35,37,42,45-46H,17-18,21,23-24H2/b27-19-/t33-,34+,35-,37-/m1/s1 |
| InChIKey | MWONCQSAYATLRU-OMCNKPROSA-N |
| XLogP | 4.99 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|