C42H42N2O5 — CID 23918576
(3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23918576) has the molecular formula C42H42N2O5 and a molecular weight of 654.81 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23918576 |
| Molecular Formula | C42H42N2O5 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(3E)-3-[(3-hydroxyphenyl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC/C(=C\c1cccc(O)c1)CC[C@H]1OC[C@H]2C1=C(COc1ccccc1)C[C@H]1C(=O)N(c3ccc(Nc4ccccc4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C42H42N2O5/c1-2-10-28(23-29-11-9-14-34(45)24-29)17-22-38-39-30(26-48-35-15-7-4-8-16-35)25-36-40(37(39)27-49-38)42(47)44(41(36)46)33-20-18-32(19-21-33)43-31-12-5-3-6-13-31/h3-9,11-16,18-21,23-24,36-38,40,43,45H,2,10,17,22,25-27H2,1H3/b28-23+/t36-,37+,38-,40-/m1/s1 |
| InChIKey | FXYGJTUELBHVKR-QHFUXFEBSA-N |
| XLogP | 8.70 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|