C44H40N2O5 — CID 23890789
(3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxynaphthalen-1-yl)-3-methylbut-3-enyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23890789) has the molecular formula C44H40N2O5 and a molecular weight of 676.81 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxynaphthalen-1-yl)-3-methylbut-3-enyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxynaphthalen-1-yl)-3-methylbut-3-enyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23890789 |
| Molecular Formula | C44H40N2O5 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxynaphthalen-1-yl)-3-methylbut-3-enyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | C/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OC[C@H]2C1=C(COc1ccccc1)C[C@H]1C(=O)N(c3ccc(Nc4ccccc4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C44H40N2O5/c1-28(24-29-17-22-39(47)36-15-9-8-14-35(29)36)16-23-40-41-30(26-50-34-12-6-3-7-13-34)25-37-42(38(41)27-51-40)44(49)46(43(37)48)33-20-18-32(19-21-33)45-31-10-4-2-5-11-31/h2-15,17-22,24,37-38,40,42,45,47H,16,23,25-27H2,1H3/b28-24+/t37-,38+,40-,42-/m1/s1 |
| InChIKey | MLHUGDKNFXCYTD-LZEMDTJUSA-N |
| XLogP | 9.07 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|