C40H45NO5 — CID 23974816
(3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23974816) has the molecular formula C40H45NO5 and a molecular weight of 619.80 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23974816 |
| Molecular Formula | C40H45NO5 |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(3E)-3-[(4-hydroxynaphthalen-1-yl)methylidene]hexyl]-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CCC/C(=C\c1ccc(O)c2ccccc12)CC[C@H]1OC[C@H]2C1=C(COc1ccccc1)C[C@H]1C(=O)N(C3CCCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C40H45NO5/c1-2-11-26(22-27-19-20-35(42)32-17-10-9-16-31(27)32)18-21-36-37-28(24-45-30-14-7-4-8-15-30)23-33-38(34(37)25-46-36)40(44)41(39(33)43)29-12-5-3-6-13-29/h4,7-10,14-17,19-20,22,29,33-34,36,38,42H,2-3,5-6,11-13,18,21,23-25H2,1H3/b26-22+/t33-,34+,36-,38-/m1/s1 |
| InChIKey | HLDFGOCWENKLRC-TUDHZTJZSA-N |
| XLogP | 8.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|