C34H38ClNO5 — CID 23974690
(3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-cyclohexyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23974690) has the molecular formula C34H38ClNO5 and a molecular weight of 576.13 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-cyclohexyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-cyclohexyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23974690 |
| Molecular Formula | C34H38ClNO5 |
| Molecular Weight | 576.13 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-7-cyclohexyl-4-(phenoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | C/C(=C\c1ccc(O)cc1Cl)CC[C@H]1OC[C@H]2C1=C(COc1ccccc1)C[C@H]1C(=O)N(C3CCCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C34H38ClNO5/c1-21(16-22-13-14-25(37)18-29(22)35)12-15-30-31-23(19-40-26-10-6-3-7-11-26)17-27-32(28(31)20-41-30)34(39)36(33(27)38)24-8-4-2-5-9-24/h3,6-7,10-11,13-14,16,18,24,27-28,30,32,37H,2,4-5,8-9,12,15,17,19-20H2,1H3/b21-16+/t27-,28+,30-,32-/m1/s1 |
| InChIKey | KQJPITNPDLDKCM-BWQCTBOKSA-N |
| XLogP | 6.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.13 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|