C29H37NO5 — CID 23834345
(3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23834345) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23834345 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxyphenyl)-3-methylbut-3-enyl]-4-(methoxymethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | COCC1=C2[C@@H](CC/C(C)=C/c3ccc(O)cc3)OC[C@@H]2[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H37NO5/c1-18(14-19-9-11-22(31)12-10-19)8-13-25-26-20(16-34-2)15-23-27(24(26)17-35-25)29(33)30(28(23)32)21-6-4-3-5-7-21/h9-12,14,21,23-25,27,31H,3-8,13,15-17H2,1-2H3/b18-14+/t23-,24+,25-,27-/m1/s1 |
| InChIKey | IIVRBGUXEVOXSJ-SHXRMJAWSA-N |
| XLogP | 4.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|