C31H40INO5 — CID 23974769
(3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23974769) has the molecular formula C31H40INO5 and a molecular weight of 633.57 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23974769 |
| Molecular Formula | C31H40INO5 |
| Molecular Weight | 633.57 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-cyclohexyl-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | COc1cc(/C=C(\C)CC[C@H]2OC[C@H]3C2=C(C(C)C)C[C@H]2C(=O)N(C4CCCCC4)C(=O)[C@H]23)cc(I)c1O |
| InChI | InChI=1S/C31H40INO5/c1-17(2)21-15-22-28(31(36)33(30(22)35)20-8-6-5-7-9-20)23-16-38-25(27(21)23)11-10-18(3)12-19-13-24(32)29(34)26(14-19)37-4/h12-14,17,20,22-23,25,28,34H,5-11,15-16H2,1-4H3/b18-12+/t22-,23+,25-,28-/m1/s1 |
| InChIKey | URMQTKPLZPBYFT-CANFGCPLSA-N |
| XLogP | 6.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|