C35H35IN2O5 — CID 23805815
(3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23805815) has the molecular formula C35H35IN2O5 and a molecular weight of 690.58 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23805815 |
| Molecular Formula | C35H35IN2O5 |
| Molecular Weight | 690.58 g/mol |
| Exact Mass | 690.16 |
| IUPAC Name | (3R,5aR,8aS,8bR)-7-(4-anilinophenyl)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-methyl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | COc1cc(/C=C(\C)CC[C@H]2OC[C@H]3C2=C(C)C[C@H]2C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)[C@H]23)cc(I)c1O |
| InChI | InChI=1S/C35H35IN2O5/c1-20(15-22-17-28(36)33(39)30(18-22)42-3)9-14-29-31-21(2)16-26-32(27(31)19-43-29)35(41)38(34(26)40)25-12-10-24(11-13-25)37-23-7-5-4-6-8-23/h4-8,10-13,15,17-18,26-27,29,32,37,39H,9,14,16,19H2,1-3H3/b20-15+/t26-,27+,29-,32-/m1/s1 |
| InChIKey | BXYANMRMNFGFLE-HVOHVTIPSA-N |
| XLogP | 7.47 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|