C29H31BINO8 — CID 23862932
[3-[(3R,5aR,8aS,8bR)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-(hydroxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid (PubChem CID 23862932) has the molecular formula C29H31BINO8 and a molecular weight of 659.28 g/mol. Its IUPAC name is [3-[(3R,5aR,8aS,8bR)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-(hydroxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid.
| Compound Name | [3-[(3R,5aR,8aS,8bR)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-(hydroxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23862932 |
| Molecular Formula | C29H31BINO8 |
| Molecular Weight | 659.28 g/mol |
| Exact Mass | 659.12 |
| IUPAC Name | [3-[(3R,5aR,8aS,8bR)-3-[(E)-4-(4-hydroxy-3-iodo-5-methoxyphenyl)-3-methylbut-3-enyl]-4-(hydroxymethyl)-6,8-dioxo-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]phenyl]boronic acid |
| SMILES | COc1cc(/C=C(\C)CC[C@H]2OC[C@H]3C2=C(CO)C[C@H]2C(=O)N(c4cccc(B(O)O)c4)C(=O)[C@H]23)cc(I)c1O |
| InChI | InChI=1S/C29H31BINO8/c1-15(8-16-9-22(31)27(34)24(10-16)39-2)6-7-23-25-17(13-33)11-20-26(21(25)14-40-23)29(36)32(28(20)35)19-5-3-4-18(12-19)30(37)38/h3-5,8-10,12,20-21,23,26,33-34,37-38H,6-7,11,13-14H2,1-2H3/b15-8+/t20-,21+,23-,26-/m1/s1 |
| InChIKey | LJSRCWHABVJCTR-AGVRHZOESA-N |
| XLogP | 2.38 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|