C35H40ClNO4 — CID 23805740
(3R,5aR,8aS,8bR)-3-[(Z)-4-(2-chloro-4-hydroxyphenyl)-3-phenylbut-3-enyl]-7-cyclohexyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23805740) has the molecular formula C35H40ClNO4 and a molecular weight of 574.16 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(Z)-4-(2-chloro-4-hydroxyphenyl)-3-phenylbut-3-enyl]-7-cyclohexyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(2-chloro-4-hydroxyphenyl)-3-phenylbut-3-enyl]-7-cyclohexyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23805740 |
| Molecular Formula | C35H40ClNO4 |
| Molecular Weight | 574.16 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(Z)-4-(2-chloro-4-hydroxyphenyl)-3-phenylbut-3-enyl]-7-cyclohexyl-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | CC(C)C1=C2[C@@H](CC/C(=C/c3ccc(O)cc3Cl)c3ccccc3)OC[C@@H]2[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H40ClNO4/c1-21(2)27-19-28-33(35(40)37(34(28)39)25-11-7-4-8-12-25)29-20-41-31(32(27)29)16-14-23(22-9-5-3-6-10-22)17-24-13-15-26(38)18-30(24)36/h3,5-6,9-10,13,15,17-18,21,25,28-29,31,33,38H,4,7-8,11-12,14,16,19-20H2,1-2H3/b23-17-/t28-,29+,31-,33-/m1/s1 |
| InChIKey | JJGRYFBHMDJSNV-APRBTKNJSA-N |
| XLogP | 7.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.16 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|