C29H32ClNO4S — CID 23776648
(3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione (PubChem CID 23776648) has the molecular formula C29H32ClNO4S and a molecular weight of 526.10 g/mol. Its IUPAC name is (3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione.
| Compound Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
|---|---|
| PubChem CID | 23776648 |
| Molecular Formula | C29H32ClNO4S |
| Molecular Weight | 526.10 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | (3R,5aR,8aS,8bR)-3-[(E)-4-(2-chloro-4-hydroxyphenyl)-3-methylbut-3-enyl]-4-propan-2-yl-7-(thiophen-2-ylmethyl)-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindole-6,8-dione |
| SMILES | C/C(=C\c1ccc(O)cc1Cl)CC[C@H]1OC[C@H]2C1=C(C(C)C)C[C@H]1C(=O)N(Cc3cccs3)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H32ClNO4S/c1-16(2)21-13-22-27(29(34)31(28(22)33)14-20-5-4-10-36-20)23-15-35-25(26(21)23)9-6-17(3)11-18-7-8-19(32)12-24(18)30/h4-5,7-8,10-12,16,22-23,25,27,32H,6,9,13-15H2,1-3H3/b17-11+/t22-,23+,25-,27-/m1/s1 |
| InChIKey | VOWBUBUUCKSVDT-DJHJDPQJSA-N |
| XLogP | 6.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.10 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|