C30H38BrNO6 — CID 23776709
6-[(3R,5aR,8aS,8bR)-3-[(E)-4-(5-bromo-2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid (PubChem CID 23776709) has the molecular formula C30H38BrNO6 and a molecular weight of 588.54 g/mol. Its IUPAC name is 6-[(3R,5aR,8aS,8bR)-3-[(E)-4-(5-bromo-2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid.
| Compound Name | 6-[(3R,5aR,8aS,8bR)-3-[(E)-4-(5-bromo-2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 23776709 |
| Molecular Formula | C30H38BrNO6 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 6-[(3R,5aR,8aS,8bR)-3-[(E)-4-(5-bromo-2-hydroxyphenyl)-3-methylbut-3-enyl]-6,8-dioxo-4-propan-2-yl-1,3,5,5a,8a,8b-hexahydrofuro[3,4-e]isoindol-7-yl]hexanoic acid |
| SMILES | C/C(=C\c1cc(Br)ccc1O)CC[C@H]1OC[C@H]2C1=C(C(C)C)C[C@H]1C(=O)N(CCCCCC(=O)O)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H38BrNO6/c1-17(2)21-15-22-28(30(37)32(29(22)36)12-6-4-5-7-26(34)35)23-16-38-25(27(21)23)11-8-18(3)13-19-14-20(31)9-10-24(19)33/h9-10,13-14,17,22-23,25,28,33H,4-8,11-12,15-16H2,1-3H3,(H,34,35)/b18-13+/t22-,23+,25-,28-/m1/s1 |
| InChIKey | HWVMDOVLSRUADN-GALBQGEDSA-N |
| XLogP | 5.96 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|